C25H41NO3 — CID 142945990
cyclohexane;4-(diethylamino)but-2-ynyl 2-hydroxy-2-phenylpropanoate;ethane (PubChem CID 142945990) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is cyclohexane;4-(diethylamino)but-2-ynyl 2-hydroxy-2-phenylpropanoate;ethane.
| Compound Name | cyclohexane;4-(diethylamino)but-2-ynyl 2-hydroxy-2-phenylpropanoate;ethane |
|---|---|
| PubChem CID | 142945990 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | cyclohexane;4-(diethylamino)but-2-ynyl 2-hydroxy-2-phenylpropanoate;ethane |
| SMILES | C1CCCCC1.CC.CCN(CC)CC#CCOC(=O)C(C)(O)c1ccccc1 |
| InChI | InChI=1S/C17H23NO3.C6H12.C2H6/c1-4-18(5-2)13-9-10-14-21-16(19)17(3,20)15-11-7-6-8-12-15;1-2-4-6-5-3-1;1-2/h6-8,11-12,20H,4-5,13-14H2,1-3H3;1-6H2;1-2H3 |
| InChIKey | NDTVOCHVROZSKS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|