C24H35NO3 — CID 170568282
4-(diethylamino)but-2-ynyl 3-cyclohexylidene-2-phenylpropanoate;methanol (PubChem CID 170568282) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is 4-(diethylamino)but-2-ynyl 3-cyclohexylidene-2-phenylpropanoate;methanol.
| Compound Name | 4-(diethylamino)but-2-ynyl 3-cyclohexylidene-2-phenylpropanoate;methanol |
|---|---|
| PubChem CID | 170568282 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 4-(diethylamino)but-2-ynyl 3-cyclohexylidene-2-phenylpropanoate;methanol |
| SMILES | CCN(CC)CC#CCOC(=O)C(C=C1CCCCC1)c1ccccc1.CO |
| InChI | InChI=1S/C23H31NO2.CH4O/c1-3-24(4-2)17-11-12-18-26-23(25)22(21-15-9-6-10-16-21)19-20-13-7-5-8-14-20;1-2/h6,9-10,15-16,19,22H,3-5,7-8,13-14,17-18H2,1-2H3;2H,1H3 |
| InChIKey | HZILURLMROHRRR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|