C16H21FO4P+ — CID 57273098
(2-carboxy-1-fluoro-2-phenylethyl)-(cyclohexylidenemethyl)-dihydroxyphosphanium (PubChem CID 57273098) has the molecular formula C16H21FO4P+ and a molecular weight of 327.31 g/mol. Its IUPAC name is (2-carboxy-1-fluoro-2-phenylethyl)-(cyclohexylidenemethyl)-dihydroxyphosphanium.
| Compound Name | (2-carboxy-1-fluoro-2-phenylethyl)-(cyclohexylidenemethyl)-dihydroxyphosphanium |
|---|---|
| PubChem CID | 57273098 |
| Molecular Formula | C16H21FO4P+ |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (2-carboxy-1-fluoro-2-phenylethyl)-(cyclohexylidenemethyl)-dihydroxyphosphanium |
| SMILES | O=C(O)C(c1ccccc1)C(F)[P+](O)(O)C=C1CCCCC1 |
| InChI | InChI=1S/C16H20FO4P/c17-15(14(16(18)19)13-9-5-2-6-10-13)22(20,21)11-12-7-3-1-4-8-12/h2,5-6,9-11,14-15,20-21H,1,3-4,7-8H2/p+1 |
| InChIKey | MFXSUOMKHOCUSB-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|