C16H22O5P+ — CID 56989826
(1-carboxy-1-phenylbutan-2-yl)-dihydroxy-(oxolan-2-ylidenemethyl)phosphanium (PubChem CID 56989826) has the molecular formula C16H22O5P+ and a molecular weight of 325.32 g/mol. Its IUPAC name is (1-carboxy-1-phenylbutan-2-yl)-dihydroxy-(oxolan-2-ylidenemethyl)phosphanium.
| Compound Name | (1-carboxy-1-phenylbutan-2-yl)-dihydroxy-(oxolan-2-ylidenemethyl)phosphanium |
|---|---|
| PubChem CID | 56989826 |
| Molecular Formula | C16H22O5P+ |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (1-carboxy-1-phenylbutan-2-yl)-dihydroxy-(oxolan-2-ylidenemethyl)phosphanium |
| SMILES | CCC(C(C(=O)O)c1ccccc1)[P+](O)(O)C=C1CCCO1 |
| InChI | InChI=1S/C16H21O5P/c1-2-14(22(19,20)11-13-9-6-10-21-13)15(16(17)18)12-7-4-3-5-8-12/h3-5,7-8,11,14-15,19-20H,2,6,9-10H2,1H3/p+1 |
| InChIKey | SFMSZIXMHJVRBE-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|