C31H44O4 — CID 174848534
2,3-diphenylbutanoic acid;oxacyclohexadecan-2-one (PubChem CID 174848534) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is 2,3-diphenylbutanoic acid;oxacyclohexadecan-2-one.
| Compound Name | 2,3-diphenylbutanoic acid;oxacyclohexadecan-2-one |
|---|---|
| PubChem CID | 174848534 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 2,3-diphenylbutanoic acid;oxacyclohexadecan-2-one |
| SMILES | CC(c1ccccc1)C(C(=O)O)c1ccccc1.O=C1CCCCCCCCCCCCCCO1 |
| InChI | InChI=1S/C16H16O2.C15H28O2/c1-12(13-8-4-2-5-9-13)15(16(17)18)14-10-6-3-7-11-14;16-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-17-15/h2-12,15H,1H3,(H,17,18);1-14H2 |
| InChIKey | VRPSQDWULCOPLB-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |