C22H32O10 — CID 66962406
1,8-dioxacyclotetradecane-2,7-dione;ethane-1,2-diol;terephthalic acid (PubChem CID 66962406) has the molecular formula C22H32O10 and a molecular weight of 456.49 g/mol. Its IUPAC name is 1,8-dioxacyclotetradecane-2,7-dione;ethane-1,2-diol;terephthalic acid.
| Compound Name | 1,8-dioxacyclotetradecane-2,7-dione;ethane-1,2-diol;terephthalic acid |
|---|---|
| PubChem CID | 66962406 |
| Molecular Formula | C22H32O10 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 1,8-dioxacyclotetradecane-2,7-dione;ethane-1,2-diol;terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)cc1.O=C1CCCCC(=O)OCCCCCCO1.OCCO |
| InChI | InChI=1S/C12H20O4.C8H6O4.C2H6O2/c13-11-7-3-4-8-12(14)16-10-6-2-1-5-9-15-11;9-7(10)5-1-2-6(4-3-5)8(11)12;3-1-2-4/h1-10H2;1-4H,(H,9,10)(H,11,12);3-4H,1-2H2 |
| InChIKey | BPDJQMCWENSGEK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |