About cyclopropane;4-(hydroxymethyl)benzoic acid
cyclopropane;4-(hydroxymethyl)benzoic acid (PubChem CID 67743038) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is cyclopropane;4-(hydroxymethyl)benzoic acid.
Molecular Properties
| Compound Name | cyclopropane;4-(hydroxymethyl)benzoic acid |
| PubChem CID | 67743038 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | cyclopropane;4-(hydroxymethyl)benzoic acid |
| SMILES | C1CC1.O=C(O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C8H8O3.C3H6/c9-5-6-1-3-7(4-2-6)8(10)11;1-2-3-1/h1-4,9H,5H2,(H,10,11);1-3H2 |
| InChIKey | ZVTUVXKTUXIJPV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropane;4-(hydroxymethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;4-(hydroxymethyl)benzoic acid?
The IUPAC name of cyclopropane;4-(hydroxymethyl)benzoic acid (CID 67743038) is cyclopropane;4-(hydroxymethyl)benzoic acid.
What is the SMILES notation for cyclopropane;4-(hydroxymethyl)benzoic acid?
The canonical SMILES for cyclopropane;4-(hydroxymethyl)benzoic acid is C1CC1.O=C(O)c1ccc(CO)cc1.
What is the InChIKey of cyclopropane;4-(hydroxymethyl)benzoic acid?
The InChIKey is ZVTUVXKTUXIJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C3H6/c9-5-6-1-3-7(4-2-6)8(10)11;1-2-3-1/h1-4,9H,5H2,(H,10,11);1-3H2.
What are the key properties of cyclopropane;4-(hydroxymethyl)benzoic acid?
cyclopropane;4-(hydroxymethyl)benzoic acid has a molecular weight of 194.23 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;4-(hydroxymethyl)benzoic acid is sourced from PubChem (CID 67743038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).