C26H30O5 — CID 67807487
4-cyclohex-2-en-1-yloxybenzoic acid;(4-cyclohex-2-en-1-yloxyphenyl)methanol (PubChem CID 67807487) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is 4-cyclohex-2-en-1-yloxybenzoic acid;(4-cyclohex-2-en-1-yloxyphenyl)methanol.
| Compound Name | 4-cyclohex-2-en-1-yloxybenzoic acid;(4-cyclohex-2-en-1-yloxyphenyl)methanol |
|---|---|
| PubChem CID | 67807487 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 4-cyclohex-2-en-1-yloxybenzoic acid;(4-cyclohex-2-en-1-yloxyphenyl)methanol |
| SMILES | O=C(O)c1ccc(OC2C=CCCC2)cc1.OCc1ccc(OC2C=CCCC2)cc1 |
| InChI | InChI=1S/C13H14O3.C13H16O2/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11;14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12/h2,4,6-9,11H,1,3,5H2,(H,14,15);2,4,6-9,12,14H,1,3,5,10H2 |
| InChIKey | ULSLPDNHWPWZEE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|