C30H34O2 — CID 5357270
1-cyclohex-2-en-1-yloxy-4-[(2Z,4Z)-4-(4-cyclohex-2-en-1-yloxyphenyl)hexa-2,4-dien-3-yl]benzene (PubChem CID 5357270) has the molecular formula C30H34O2 and a molecular weight of 426.60 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yloxy-4-[(2Z,4Z)-4-(4-cyclohex-2-en-1-yloxyphenyl)hexa-2,4-dien-3-yl]benzene.
| Compound Name | 1-cyclohex-2-en-1-yloxy-4-[(2Z,4Z)-4-(4-cyclohex-2-en-1-yloxyphenyl)hexa-2,4-dien-3-yl]benzene |
|---|---|
| PubChem CID | 5357270 |
| Molecular Formula | C30H34O2 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 1-cyclohex-2-en-1-yloxy-4-[(2Z,4Z)-4-(4-cyclohex-2-en-1-yloxyphenyl)hexa-2,4-dien-3-yl]benzene |
| SMILES | C/C=C(C(=C/C)\c1ccc(OC2C=CCCC2)cc1)/c1ccc(OC2C=CCCC2)cc1 |
| InChI | InChI=1S/C30H34O2/c1-3-29(23-15-19-27(20-16-23)31-25-11-7-5-8-12-25)30(4-2)24-17-21-28(22-18-24)32-26-13-9-6-10-14-26/h3-4,7,9,11,13,15-22,25-26H,5-6,8,10,12,14H2,1-2H3/b29-3-,30-4- |
| InChIKey | RFVHQUFSFGUNNM-WZDDHJGQSA-N |
| XLogP | 8.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|