C13H16O — CID 91516514
1-cyclohex-2-en-1-yloxy-3-methylbenzene (PubChem CID 91516514) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yloxy-3-methylbenzene.
| Compound Name | 1-cyclohex-2-en-1-yloxy-3-methylbenzene |
|---|---|
| PubChem CID | 91516514 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-cyclohex-2-en-1-yloxy-3-methylbenzene |
| SMILES | Cc1cccc(OC2C=CCCC2)c1 |
| InChI | InChI=1S/C13H16O/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12/h3,5-7,9-10,12H,2,4,8H2,1H3 |
| InChIKey | YOUGNMCIZKDIBW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|