C18H23NO4 — CID 102234788
[(3-cyclohex-2-en-1-yloxybenzoyl)amino] 2,2-dimethylpropanoate (PubChem CID 102234788) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is [(3-cyclohex-2-en-1-yloxybenzoyl)amino] 2,2-dimethylpropanoate.
| Compound Name | [(3-cyclohex-2-en-1-yloxybenzoyl)amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102234788 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [(3-cyclohex-2-en-1-yloxybenzoyl)amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ONC(=O)c1cccc(OC2C=CCCC2)c1 |
| InChI | InChI=1S/C18H23NO4/c1-18(2,3)17(21)23-19-16(20)13-8-7-11-15(12-13)22-14-9-5-4-6-10-14/h5,7-9,11-12,14H,4,6,10H2,1-3H3,(H,19,20) |
| InChIKey | RXQBAWRJGWKVQX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|