C16H21NO — CID 114619665
N-[(3-cyclohex-2-en-1-yloxyphenyl)methyl]cyclopropanamine (PubChem CID 114619665) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[(3-cyclohex-2-en-1-yloxyphenyl)methyl]cyclopropanamine.
| Compound Name | N-[(3-cyclohex-2-en-1-yloxyphenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114619665 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-[(3-cyclohex-2-en-1-yloxyphenyl)methyl]cyclopropanamine |
| SMILES | C1=CC(Oc2cccc(CNC3CC3)c2)CCC1 |
| InChI | InChI=1S/C16H21NO/c1-2-6-15(7-3-1)18-16-8-4-5-13(11-16)12-17-14-9-10-14/h2,4-6,8,11,14-15,17H,1,3,7,9-10,12H2 |
| InChIKey | QERKCZLFLACNIN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|