C16H23O7PS — CID 19705869
4-(3-cyclohex-2-en-1-yloxyphenyl)-1-phosphonobutane-1-sulfonic acid (PubChem CID 19705869) has the molecular formula C16H23O7PS and a molecular weight of 390.39 g/mol. Its IUPAC name is 4-(3-cyclohex-2-en-1-yloxyphenyl)-1-phosphonobutane-1-sulfonic acid.
| Compound Name | 4-(3-cyclohex-2-en-1-yloxyphenyl)-1-phosphonobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 19705869 |
| Molecular Formula | C16H23O7PS |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-(3-cyclohex-2-en-1-yloxyphenyl)-1-phosphonobutane-1-sulfonic acid |
| SMILES | O=P(O)(O)C(CCCc1cccc(OC2C=CCCC2)c1)S(=O)(=O)O |
| InChI | InChI=1S/C16H23O7PS/c17-24(18,19)16(25(20,21)22)11-5-7-13-6-4-10-15(12-13)23-14-8-2-1-3-9-14/h2,4,6,8,10,12,14,16H,1,3,5,7,9,11H2,(H2,17,18,19)(H,20,21,22) |
| InChIKey | JTJYDTNOGCVAEG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|