C16H19O7PS — CID 24748047
(1R)-4-(3-phenoxyphenyl)-1-phosphonobutane-1-sulfonic acid (PubChem CID 24748047) has the molecular formula C16H19O7PS and a molecular weight of 386.36 g/mol. Its IUPAC name is (1R)-4-(3-phenoxyphenyl)-1-phosphonobutane-1-sulfonic acid.
| Compound Name | (1R)-4-(3-phenoxyphenyl)-1-phosphonobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 24748047 |
| Molecular Formula | C16H19O7PS |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (1R)-4-(3-phenoxyphenyl)-1-phosphonobutane-1-sulfonic acid |
| SMILES | O=P(O)(O)[C@@H](CCCc1cccc(Oc2ccccc2)c1)S(=O)(=O)O |
| InChI | InChI=1S/C16H19O7PS/c17-24(18,19)16(25(20,21)22)11-5-7-13-6-4-10-15(12-13)23-14-8-2-1-3-9-14/h1-4,6,8-10,12,16H,5,7,11H2,(H2,17,18,19)(H,20,21,22)/t16-/m1/s1 |
| InChIKey | RCGCZPXSRLLKCK-MRXNPFEDSA-N |
| XLogP | 3.19 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|