C24H35O7PS — CID 10553381
4-[3-(2-butylphenoxy)phenyl]-1-diethoxyphosphorylbutane-1-sulfonic acid (PubChem CID 10553381) has the molecular formula C24H35O7PS and a molecular weight of 498.58 g/mol. Its IUPAC name is 4-[3-(2-butylphenoxy)phenyl]-1-diethoxyphosphorylbutane-1-sulfonic acid.
| Compound Name | 4-[3-(2-butylphenoxy)phenyl]-1-diethoxyphosphorylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 10553381 |
| Molecular Formula | C24H35O7PS |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 4-[3-(2-butylphenoxy)phenyl]-1-diethoxyphosphorylbutane-1-sulfonic acid |
| SMILES | CCCCc1ccccc1Oc1cccc(CCCC(P(=O)(OCC)OCC)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C24H35O7PS/c1-4-7-14-21-15-8-9-17-23(21)31-22-16-10-12-20(19-22)13-11-18-24(33(26,27)28)32(25,29-5-2)30-6-3/h8-10,12,15-17,19,24H,4-7,11,13-14,18H2,1-3H3,(H,26,27,28) |
| InChIKey | ZDJNAVIFIFCOTF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|