C32H41O8PS — CID 10770111
cyclohexyl 1-diethoxyphosphoryl-4-[3-(2-phenoxyphenoxy)phenyl]butane-1-sulfonate (PubChem CID 10770111) has the molecular formula C32H41O8PS and a molecular weight of 616.71 g/mol. Its IUPAC name is cyclohexyl 1-diethoxyphosphoryl-4-[3-(2-phenoxyphenoxy)phenyl]butane-1-sulfonate.
| Compound Name | cyclohexyl 1-diethoxyphosphoryl-4-[3-(2-phenoxyphenoxy)phenyl]butane-1-sulfonate |
|---|---|
| PubChem CID | 10770111 |
| Molecular Formula | C32H41O8PS |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | cyclohexyl 1-diethoxyphosphoryl-4-[3-(2-phenoxyphenoxy)phenyl]butane-1-sulfonate |
| SMILES | CCOP(=O)(OCC)C(CCCc1cccc(Oc2ccccc2Oc2ccccc2)c1)S(=O)(=O)OC1CCCCC1 |
| InChI | InChI=1S/C32H41O8PS/c1-3-36-41(33,37-4-2)32(42(34,35)40-28-19-9-6-10-20-28)24-14-16-26-15-13-21-29(25-26)39-31-23-12-11-22-30(31)38-27-17-7-5-8-18-27/h5,7-8,11-13,15,17-18,21-23,25,28,32H,3-4,6,9-10,14,16,19-20,24H2,1-2H3 |
| InChIKey | NMIROHHOSREZBG-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|