C18H32O6P2 — CID 10150860
4,4-bis(diethoxyphosphoryl)butylbenzene (PubChem CID 10150860) has the molecular formula C18H32O6P2 and a molecular weight of 406.40 g/mol. Its IUPAC name is 4,4-bis(diethoxyphosphoryl)butylbenzene.
| Compound Name | 4,4-bis(diethoxyphosphoryl)butylbenzene |
|---|---|
| PubChem CID | 10150860 |
| Molecular Formula | C18H32O6P2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 4,4-bis(diethoxyphosphoryl)butylbenzene |
| SMILES | CCOP(=O)(OCC)C(CCCc1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H32O6P2/c1-5-21-25(19,22-6-2)18(26(20,23-7-3)24-8-4)16-12-15-17-13-10-9-11-14-17/h9-11,13-14,18H,5-8,12,15-16H2,1-4H3 |
| InChIKey | YDQDTNCOLCPTEX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|