C19H25O5P — CID 102333800
(1R,2R)-2-diethoxyphosphoryl-1-phenyl-2-phenylmethoxyethanol (PubChem CID 102333800) has the molecular formula C19H25O5P and a molecular weight of 364.38 g/mol. Its IUPAC name is (1R,2R)-2-diethoxyphosphoryl-1-phenyl-2-phenylmethoxyethanol.
| Compound Name | (1R,2R)-2-diethoxyphosphoryl-1-phenyl-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 102333800 |
| Molecular Formula | C19H25O5P |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (1R,2R)-2-diethoxyphosphoryl-1-phenyl-2-phenylmethoxyethanol |
| SMILES | CCOP(=O)(OCC)[C@@H](OCc1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H25O5P/c1-3-23-25(21,24-4-2)19(18(20)17-13-9-6-10-14-17)22-15-16-11-7-5-8-12-16/h5-14,18-20H,3-4,15H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | ALQBAVMROPXYSC-RTBURBONSA-N |
| XLogP | 4.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|