C23H43NO7P2 — CID 10839334
4,4-bis(diethoxyphosphoryl)-N,N-diethyl-2-phenylmethoxybutan-1-amine (PubChem CID 10839334) has the molecular formula C23H43NO7P2 and a molecular weight of 507.55 g/mol. Its IUPAC name is 4,4-bis(diethoxyphosphoryl)-N,N-diethyl-2-phenylmethoxybutan-1-amine.
| Compound Name | 4,4-bis(diethoxyphosphoryl)-N,N-diethyl-2-phenylmethoxybutan-1-amine |
|---|---|
| PubChem CID | 10839334 |
| Molecular Formula | C23H43NO7P2 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 4,4-bis(diethoxyphosphoryl)-N,N-diethyl-2-phenylmethoxybutan-1-amine |
| SMILES | CCOP(=O)(OCC)C(CC(CN(CC)CC)OCc1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C23H43NO7P2/c1-7-24(8-2)19-22(27-20-21-16-14-13-15-17-21)18-23(32(25,28-9-3)29-10-4)33(26,30-11-5)31-12-6/h13-17,22-23H,7-12,18-20H2,1-6H3 |
| InChIKey | UDGPCAGOWABNER-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|