C21H39NO4P2 — CID 15506156
2-[tert-butyl(phenyl)phosphoryl]-3-diethoxyphosphoryl-N,N-diethylpropan-1-amine (PubChem CID 15506156) has the molecular formula C21H39NO4P2 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-[tert-butyl(phenyl)phosphoryl]-3-diethoxyphosphoryl-N,N-diethylpropan-1-amine.
| Compound Name | 2-[tert-butyl(phenyl)phosphoryl]-3-diethoxyphosphoryl-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 15506156 |
| Molecular Formula | C21H39NO4P2 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 2-[tert-butyl(phenyl)phosphoryl]-3-diethoxyphosphoryl-N,N-diethylpropan-1-amine |
| SMILES | CCOP(=O)(CC(CN(CC)CC)P(=O)(c1ccccc1)C(C)(C)C)OCC |
| InChI | InChI=1S/C21H39NO4P2/c1-8-22(9-2)17-20(18-27(23,25-10-3)26-11-4)28(24,21(5,6)7)19-15-13-12-14-16-19/h12-16,20H,8-11,17-18H2,1-7H3 |
| InChIKey | HFFDBLQIYAWVDC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|