C19H27NO4P2 — CID 177454957
1-diethoxyphosphoryl-N-diphenylphosphorylpropan-1-amine (PubChem CID 177454957) has the molecular formula C19H27NO4P2 and a molecular weight of 395.38 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N-diphenylphosphorylpropan-1-amine.
| Compound Name | 1-diethoxyphosphoryl-N-diphenylphosphorylpropan-1-amine |
|---|---|
| PubChem CID | 177454957 |
| Molecular Formula | C19H27NO4P2 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-diethoxyphosphoryl-N-diphenylphosphorylpropan-1-amine |
| SMILES | CCOP(=O)(OCC)C(CC)NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H27NO4P2/c1-4-19(26(22,23-5-2)24-6-3)20-25(21,17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16,19H,4-6H2,1-3H3,(H,20,21) |
| InChIKey | UVEUCWREEWZASH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|