C13H21FO5P2 — CID 10449767
[[(S)-diethoxyphosphoryl(fluoro)methyl]-ethoxyphosphoryl]benzene (PubChem CID 10449767) has the molecular formula C13H21FO5P2 and a molecular weight of 338.25 g/mol. Its IUPAC name is [[(S)-diethoxyphosphoryl(fluoro)methyl]-ethoxyphosphoryl]benzene.
| Compound Name | [[(S)-diethoxyphosphoryl(fluoro)methyl]-ethoxyphosphoryl]benzene |
|---|---|
| PubChem CID | 10449767 |
| Molecular Formula | C13H21FO5P2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | [[(S)-diethoxyphosphoryl(fluoro)methyl]-ethoxyphosphoryl]benzene |
| SMILES | CCOP(=O)(OCC)[C@@H](F)[P@@](=O)(OCC)c1ccccc1 |
| InChI | InChI=1S/C13H21FO5P2/c1-4-17-20(15,12-10-8-7-9-11-12)13(14)21(16,18-5-2)19-6-3/h7-11,13H,4-6H2,1-3H3/t13-,20-/m0/s1 |
| InChIKey | RWFQKNGBEUIECF-RBZFPXEDSA-N |
| XLogP | 4.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|