C15H16FO3P — CID 11860165
(R)-[ethoxy(phenyl)phosphoryl]-(4-fluorophenyl)methanol (PubChem CID 11860165) has the molecular formula C15H16FO3P and a molecular weight of 294.26 g/mol. Its IUPAC name is (R)-[ethoxy(phenyl)phosphoryl]-(4-fluorophenyl)methanol.
| Compound Name | (R)-[ethoxy(phenyl)phosphoryl]-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 11860165 |
| Molecular Formula | C15H16FO3P |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (R)-[ethoxy(phenyl)phosphoryl]-(4-fluorophenyl)methanol |
| SMILES | CCO[P@](=O)(c1ccccc1)[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H16FO3P/c1-2-19-20(18,14-6-4-3-5-7-14)15(17)12-8-10-13(16)11-9-12/h3-11,15,17H,2H2,1H3/t15-,20-/m1/s1 |
| InChIKey | CYFUKEROPIFLLI-FOIQADDNSA-N |
| XLogP | 3.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|