C16H21FNO2PS — CID 11493867
ethoxy-hydroxy-phenyl-sulfanylidene-λ5-phosphane;(1R)-1-(4-fluorophenyl)ethanamine (PubChem CID 11493867) has the molecular formula C16H21FNO2PS and a molecular weight of 341.39 g/mol. Its IUPAC name is ethoxy-hydroxy-phenyl-sulfanylidene-λ5-phosphane;(1R)-1-(4-fluorophenyl)ethanamine.
| Compound Name | ethoxy-hydroxy-phenyl-sulfanylidene-λ5-phosphane;(1R)-1-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 11493867 |
| Molecular Formula | C16H21FNO2PS |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | ethoxy-hydroxy-phenyl-sulfanylidene-λ5-phosphane;(1R)-1-(4-fluorophenyl)ethanamine |
| SMILES | CCOP(O)(=S)c1ccccc1.C[C@@H](N)c1ccc(F)cc1 |
| InChI | InChI=1S/C8H10FN.C8H11O2PS/c1-6(10)7-2-4-8(9)5-3-7;1-2-10-11(9,12)8-6-4-3-5-7-8/h2-6H,10H2,1H3;3-7H,2H2,1H3,(H,9,12)/t6-;/m1./s1 |
| InChIKey | NYPQINIIRJFMBY-FYZOBXCZSA-N |
| XLogP | 3.50 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|