C9H12FO4P — CID 11042650
ethoxy-[(4-fluorophenyl)-hydroxymethyl]phosphinic acid (PubChem CID 11042650) has the molecular formula C9H12FO4P and a molecular weight of 234.16 g/mol. Its IUPAC name is ethoxy-[(4-fluorophenyl)-hydroxymethyl]phosphinic acid.
| Compound Name | ethoxy-[(4-fluorophenyl)-hydroxymethyl]phosphinic acid |
|---|---|
| PubChem CID | 11042650 |
| Molecular Formula | C9H12FO4P |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | ethoxy-[(4-fluorophenyl)-hydroxymethyl]phosphinic acid |
| SMILES | CCOP(=O)(O)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H12FO4P/c1-2-14-15(12,13)9(11)7-3-5-8(10)6-4-7/h3-6,9,11H,2H2,1H3,(H,12,13) |
| InChIKey | JJJBHKKUIZRZEF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|