C13H21O4P — CID 141142647
ethoxy-[1-(4-hydroxyphenyl)-2,2-dimethylpropyl]phosphinic acid (PubChem CID 141142647) has the molecular formula C13H21O4P and a molecular weight of 272.28 g/mol. Its IUPAC name is ethoxy-[1-(4-hydroxyphenyl)-2,2-dimethylpropyl]phosphinic acid.
| Compound Name | ethoxy-[1-(4-hydroxyphenyl)-2,2-dimethylpropyl]phosphinic acid |
|---|---|
| PubChem CID | 141142647 |
| Molecular Formula | C13H21O4P |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | ethoxy-[1-(4-hydroxyphenyl)-2,2-dimethylpropyl]phosphinic acid |
| SMILES | CCOP(=O)(O)C(c1ccc(O)cc1)C(C)(C)C |
| InChI | InChI=1S/C13H21O4P/c1-5-17-18(15,16)12(13(2,3)4)10-6-8-11(14)9-7-10/h6-9,12,14H,5H2,1-4H3,(H,15,16) |
| InChIKey | FGZKXFGWUPTDLS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|