2-ethoxy-2-(4-hydroxyphenyl)acetic acid

C10H12O4 — CID 70349017

IUPAC2-ethoxy-2-(4-hydroxyphenyl)acetic acid
SMILESCCOC(C(=O)O)c1ccc(O)cc1
InChIInChI=1S/C10H12O4/c1-2-14-9(10(12)13)7-3-5-8(11)6-4-7/h3-6,9,11H,2H2,1H3,(H,12,13)
InChIKeyAMVSTQCMPAXYSQ-UHFFFAOYSA-N
MW196.20 g/mol
LogP1.55
Rot. Bonds4

About 2-ethoxy-2-(4-hydroxyphenyl)acetic acid

2-ethoxy-2-(4-hydroxyphenyl)acetic acid (PubChem CID 70349017) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-ethoxy-2-(4-hydroxyphenyl)acetic acid.

Molecular Properties

Compound Name2-ethoxy-2-(4-hydroxyphenyl)acetic acid
PubChem CID70349017
Molecular FormulaC10H12O4
Molecular Weight196.20 g/mol
Exact Mass196.07
IUPAC Name2-ethoxy-2-(4-hydroxyphenyl)acetic acid
SMILESCCOC(C(=O)O)c1ccc(O)cc1
InChIInChI=1S/C10H12O4/c1-2-14-9(10(12)13)7-3-5-8(11)6-4-7/h3-6,9,11H,2H2,1H3,(H,12,13)
InChIKeyAMVSTQCMPAXYSQ-UHFFFAOYSA-N
XLogP1.55
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.20
LogP ≤ 51.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-ethoxy-2-(4-hydroxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-2-ethoxy-2-[4-(trifluoromethoxy)phenyl]acetic acid
CID 97052403
2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde
CID 159275151
2-aminooxy-2-(4-hydroxyphenyl)acetic acid
CID 105440395
3-ethoxy-2-(4-hydroxyphenyl)-3-oxopropanoic acid
CID 140981315
2-(3-chloro-4-fluorophenyl)-2-ethoxyacetic acid
CID 83224808
4-(1-ethoxyethyl)phenol
CID 15774870
2-ethoxy-2-[4-(phenylsulfamoyl)phenyl]acetic acid
CID 71294674
2-(3-chloro-4-methoxyphenyl)-2-ethoxyacetic acid
CID 116769331
2-ethoxy-2-(3-fluorophenyl)acetic acid
CID 68560749
2-(4-hydroxyphenyl)-3-methylpentanoic acid
CID 83820428
2-(4-methoxyphenyl)-2-propoxyacetic acid
CID 83223962
(2S)-2-[(1R)-1-(4-hydroxyphenyl)ethoxy]propanoic acid
CID 67533355

Frequently Asked Questions

What is the IUPAC name of 2-ethoxy-2-(4-hydroxyphenyl)acetic acid?
The IUPAC name of 2-ethoxy-2-(4-hydroxyphenyl)acetic acid (CID 70349017) is 2-ethoxy-2-(4-hydroxyphenyl)acetic acid.
What is the SMILES notation for 2-ethoxy-2-(4-hydroxyphenyl)acetic acid?
The canonical SMILES for 2-ethoxy-2-(4-hydroxyphenyl)acetic acid is CCOC(C(=O)O)c1ccc(O)cc1.
What is the InChIKey of 2-ethoxy-2-(4-hydroxyphenyl)acetic acid?
The InChIKey is AMVSTQCMPAXYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-2-14-9(10(12)13)7-3-5-8(11)6-4-7/h3-6,9,11H,2H2,1H3,(H,12,13).
What are the key properties of 2-ethoxy-2-(4-hydroxyphenyl)acetic acid?
2-ethoxy-2-(4-hydroxyphenyl)acetic acid has a molecular weight of 196.20 g/mol, XLogP of 1.55, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-2-(4-hydroxyphenyl)acetic acid is sourced from PubChem (CID 70349017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).