About 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde
2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde (PubChem CID 159275151) has the molecular formula C17H16F2O4
and a molecular weight of 322.31 g/mol. Its IUPAC name is 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde.
Molecular Properties
| Compound Name | 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde |
| PubChem CID | 159275151 |
| Molecular Formula | C17H16F2O4 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde |
| SMILES | CCOC(C(=O)O)c1ccc(F)cc1.O=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C10H11FO3.C7H5FO/c1-2-14-9(10(12)13)7-3-5-8(11)6-4-7;8-7-3-1-6(5-9)2-4-7/h3-6,9H,2H2,1H3,(H,12,13);1-5H |
| InChIKey | KYFFMESCWBJINB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde?
The IUPAC name of 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde (CID 159275151) is 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde.
What is the SMILES notation for 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde?
The canonical SMILES for 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde is CCOC(C(=O)O)c1ccc(F)cc1.O=Cc1ccc(F)cc1.
What is the InChIKey of 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde?
The InChIKey is KYFFMESCWBJINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO3.C7H5FO/c1-2-14-9(10(12)13)7-3-5-8(11)6-4-7;8-7-3-1-6(5-9)2-4-7/h3-6,9H,2H2,1H3,(H,12,13);1-5H.
What are the key properties of 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde?
2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde has a molecular weight of 322.31 g/mol, XLogP of 3.63, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-2-(4-fluorophenyl)acetic acid;4-fluorobenzaldehyde is sourced from PubChem (CID 159275151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).