C9H11FO3 — CID 175223595
ethane-1,2-diol;4-fluorobenzaldehyde (PubChem CID 175223595) has the molecular formula C9H11FO3 and a molecular weight of 186.18 g/mol. Its IUPAC name is ethane-1,2-diol;4-fluorobenzaldehyde.
| Compound Name | ethane-1,2-diol;4-fluorobenzaldehyde |
|---|---|
| PubChem CID | 175223595 |
| Molecular Formula | C9H11FO3 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | ethane-1,2-diol;4-fluorobenzaldehyde |
| SMILES | O=Cc1ccc(F)cc1.OCCO |
| InChI | InChI=1S/C7H5FO.C2H6O2/c8-7-3-1-6(5-9)2-4-7;3-1-2-4/h1-5H;3-4H,1-2H2 |
| InChIKey | ISHRZUWUSAMXTJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|