C17H20O2 — CID 15597034
4-[1-(4-hydroxyphenyl)-2,2-dimethylpropyl]phenol (PubChem CID 15597034) has the molecular formula C17H20O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)-2,2-dimethylpropyl]phenol.
| Compound Name | 4-[1-(4-hydroxyphenyl)-2,2-dimethylpropyl]phenol |
|---|---|
| PubChem CID | 15597034 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)-2,2-dimethylpropyl]phenol |
| SMILES | CC(C)(C)C(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H20O2/c1-17(2,3)16(12-4-8-14(18)9-5-12)13-6-10-15(19)11-7-13/h4-11,16,18-19H,1-3H3 |
| InChIKey | OMFKAAYGALHAKD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |