About methane;4-propan-2-ylphenol
methane;4-propan-2-ylphenol (PubChem CID 159328733) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is methane;4-propan-2-ylphenol.
Molecular Properties
| Compound Name | methane;4-propan-2-ylphenol |
| PubChem CID | 159328733 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | methane;4-propan-2-ylphenol |
| SMILES | C.C.C.CC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H12O.3CH4/c1-7(2)8-3-5-9(10)6-4-8;;;/h3-7,10H,1-2H3;3*1H4 |
| InChIKey | LERYGFNYUQGVCH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;4-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-propan-2-ylphenol?
The IUPAC name of methane;4-propan-2-ylphenol (CID 159328733) is methane;4-propan-2-ylphenol.
What is the SMILES notation for methane;4-propan-2-ylphenol?
The canonical SMILES for methane;4-propan-2-ylphenol is C.C.C.CC(C)c1ccc(O)cc1.
What is the InChIKey of methane;4-propan-2-ylphenol?
The InChIKey is LERYGFNYUQGVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.3CH4/c1-7(2)8-3-5-9(10)6-4-8;;;/h3-7,10H,1-2H3;3*1H4.
What are the key properties of methane;4-propan-2-ylphenol?
methane;4-propan-2-ylphenol has a molecular weight of 184.32 g/mol, XLogP of 4.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-propan-2-ylphenol is sourced from PubChem (CID 159328733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).