About ethane;phenol;1-phenyl-4-propan-2-ylbenzene
ethane;phenol;1-phenyl-4-propan-2-ylbenzene (PubChem CID 159836751) has the molecular formula C29H34O2
and a molecular weight of 414.59 g/mol. Its IUPAC name is ethane;phenol;1-phenyl-4-propan-2-ylbenzene.
Molecular Properties
| Compound Name | ethane;phenol;1-phenyl-4-propan-2-ylbenzene |
| PubChem CID | 159836751 |
| Molecular Formula | C29H34O2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | ethane;phenol;1-phenyl-4-propan-2-ylbenzene |
| SMILES | CC.CC(C)c1ccc(-c2ccccc2)cc1.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C15H16.2C6H6O.C2H6/c1-12(2)13-8-10-15(11-9-13)14-6-4-3-5-7-14;2*7-6-4-2-1-3-5-6;1-2/h3-12H,1-2H3;2*1-5,7H;1-2H3 |
| InChIKey | NOEBMHADMOOIFF-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;phenol;1-phenyl-4-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;phenol;1-phenyl-4-propan-2-ylbenzene?
The IUPAC name of ethane;phenol;1-phenyl-4-propan-2-ylbenzene (CID 159836751) is ethane;phenol;1-phenyl-4-propan-2-ylbenzene.
What is the SMILES notation for ethane;phenol;1-phenyl-4-propan-2-ylbenzene?
The canonical SMILES for ethane;phenol;1-phenyl-4-propan-2-ylbenzene is CC.CC(C)c1ccc(-c2ccccc2)cc1.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of ethane;phenol;1-phenyl-4-propan-2-ylbenzene?
The InChIKey is NOEBMHADMOOIFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.2C6H6O.C2H6/c1-12(2)13-8-10-15(11-9-13)14-6-4-3-5-7-14;2*7-6-4-2-1-3-5-6;1-2/h3-12H,1-2H3;2*1-5,7H;1-2H3.
What are the key properties of ethane;phenol;1-phenyl-4-propan-2-ylbenzene?
ethane;phenol;1-phenyl-4-propan-2-ylbenzene has a molecular weight of 414.59 g/mol, XLogP of 8.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;phenol;1-phenyl-4-propan-2-ylbenzene is sourced from PubChem (CID 159836751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).