About 4-propan-2-ylphenol;trifluoromethanesulfonate
4-propan-2-ylphenol;trifluoromethanesulfonate (PubChem CID 91607276) has the molecular formula C10H12F3O4S-
and a molecular weight of 285.26 g/mol. Its IUPAC name is 4-propan-2-ylphenol;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 4-propan-2-ylphenol;trifluoromethanesulfonate |
| PubChem CID | 91607276 |
| Molecular Formula | C10H12F3O4S- |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-propan-2-ylphenol;trifluoromethanesulfonate |
| SMILES | CC(C)c1ccc(O)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H12O.CHF3O3S/c1-7(2)8-3-5-9(10)6-4-8;2-1(3,4)8(5,6)7/h3-7,10H,1-2H3;(H,5,6,7)/p-1 |
| InChIKey | MSINLDGVQHJSKV-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-ylphenol;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylphenol;trifluoromethanesulfonate?
The IUPAC name of 4-propan-2-ylphenol;trifluoromethanesulfonate (CID 91607276) is 4-propan-2-ylphenol;trifluoromethanesulfonate.
What is the SMILES notation for 4-propan-2-ylphenol;trifluoromethanesulfonate?
The canonical SMILES for 4-propan-2-ylphenol;trifluoromethanesulfonate is CC(C)c1ccc(O)cc1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 4-propan-2-ylphenol;trifluoromethanesulfonate?
The InChIKey is MSINLDGVQHJSKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12O.CHF3O3S/c1-7(2)8-3-5-9(10)6-4-8;2-1(3,4)8(5,6)7/h3-7,10H,1-2H3;(H,5,6,7)/p-1.
What are the key properties of 4-propan-2-ylphenol;trifluoromethanesulfonate?
4-propan-2-ylphenol;trifluoromethanesulfonate has a molecular weight of 285.26 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylphenol;trifluoromethanesulfonate is sourced from PubChem (CID 91607276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).