C11H14F3NO4S2 — CID 158994806
carbanylium;(4-propan-2-ylphenyl)sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 158994806) has the molecular formula C11H14F3NO4S2 and a molecular weight of 345.36 g/mol. Its IUPAC name is carbanylium;(4-propan-2-ylphenyl)sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | carbanylium;(4-propan-2-ylphenyl)sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 158994806 |
| Molecular Formula | C11H14F3NO4S2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | carbanylium;(4-propan-2-ylphenyl)sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CC(C)c1ccc(S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc1.[CH3+] |
| InChI | InChI=1S/C10H11F3NO4S2.CH3/c1-7(2)8-3-5-9(6-4-8)19(15,16)14-20(17,18)10(11,12)13;/h3-7H,1-2H3;1H3/q-1;+1 |
| InChIKey | JQPIYRMLYBOAOK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|