C18H31BO3 — CID 165079137
4-propan-2-ylphenol;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane (PubChem CID 165079137) has the molecular formula C18H31BO3 and a molecular weight of 306.26 g/mol. Its IUPAC name is 4-propan-2-ylphenol;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane.
| Compound Name | 4-propan-2-ylphenol;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165079137 |
| Molecular Formula | C18H31BO3 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 4-propan-2-ylphenol;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
| SMILES | CC(C)B1OC(C)(C)C(C)(C)O1.CC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H19BO2.C9H12O/c1-7(2)10-11-8(3,4)9(5,6)12-10;1-7(2)8-3-5-9(10)6-4-8/h7H,1-6H3;3-7,10H,1-2H3 |
| InChIKey | UVFJQZUHIGDEFM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|