C18H30B2O4 — CID 170582116
2-propan-2-yl-1,3,2-benzodioxaborole;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane (PubChem CID 170582116) has the molecular formula C18H30B2O4 and a molecular weight of 332.06 g/mol. Its IUPAC name is 2-propan-2-yl-1,3,2-benzodioxaborole;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane.
| Compound Name | 2-propan-2-yl-1,3,2-benzodioxaborole;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 170582116 |
| Molecular Formula | C18H30B2O4 |
| Molecular Weight | 332.06 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 2-propan-2-yl-1,3,2-benzodioxaborole;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
| SMILES | CC(C)B1OC(C)(C)C(C)(C)O1.CC(C)B1Oc2ccccc2O1 |
| InChI | InChI=1S/C9H11BO2.C9H19BO2/c1-7(2)10-11-8-5-3-4-6-9(8)12-10;1-7(2)10-11-8(3,4)9(5,6)12-10/h3-7H,1-2H3;7H,1-6H3 |
| InChIKey | JJUVJBDEARHEBR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.06 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|