C18H31BO2Se — CID 154665724
propan-2-ylselanylbenzene;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane (PubChem CID 154665724) has the molecular formula C18H31BO2Se and a molecular weight of 369.22 g/mol. Its IUPAC name is propan-2-ylselanylbenzene;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane.
| Compound Name | propan-2-ylselanylbenzene;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154665724 |
| Molecular Formula | C18H31BO2Se |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | propan-2-ylselanylbenzene;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
| SMILES | CC(C)B1OC(C)(C)C(C)(C)O1.CC(C)[Se]c1ccccc1 |
| InChI | InChI=1S/C9H19BO2.C9H12Se/c1-7(2)10-11-8(3,4)9(5,6)12-10;1-8(2)10-9-6-4-3-5-7-9/h7H,1-6H3;3-8H,1-2H3 |
| InChIKey | CGOABMGOOJDDMC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|