C26H43B3O6 — CID 139203595
4,4,5,5-tetramethyl-2-[(1R)-1-phenyl-2,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane (PubChem CID 139203595) has the molecular formula C26H43B3O6 and a molecular weight of 484.06 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(1R)-1-phenyl-2,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(1R)-1-phenyl-2,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 139203595 |
| Molecular Formula | C26H43B3O6 |
| Molecular Weight | 484.06 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(1R)-1-phenyl-2,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(B2OC(C)(C)C(C)(C)O2)[C@@H](B2OC(C)(C)C(C)(C)O2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C26H43B3O6/c1-21(2)22(3,4)31-27(30-21)19(18-16-14-13-15-17-18)20(28-32-23(5,6)24(7,8)33-28)29-34-25(9,10)26(11,12)35-29/h13-17,19-20H,1-12H3/t19-/m0/s1 |
| InChIKey | PDVAPUVCCXUUHP-IBGZPJMESA-N |
| XLogP | 5.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.06 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|