C15H23BO2 — CID 139254233
2-[(1S,2S)-2-deuterio-1-phenylpropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 139254233) has the molecular formula C15H23BO2 and a molecular weight of 247.17 g/mol. Its IUPAC name is 2-[(1S,2S)-2-deuterio-1-phenylpropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1S,2S)-2-deuterio-1-phenylpropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 139254233 |
| Molecular Formula | C15H23BO2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-[(1S,2S)-2-deuterio-1-phenylpropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [2H][C@@H](C)[C@H](B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C15H23BO2/c1-6-13(12-10-8-7-9-11-12)16-17-14(2,3)15(4,5)18-16/h7-11,13H,6H2,1-5H3/t13-/m0/s1/i6D/t6-,13- |
| InChIKey | YQGVBBNHNNWTIH-VMAXHYKSSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|