C15H20BClO4 — CID 170815684
3-(4-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170815684) has the molecular formula C15H20BClO4 and a molecular weight of 310.59 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170815684 |
| Molecular Formula | C15H20BClO4 |
| Molecular Weight | 310.59 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | CC1(C)OB(C(CC(=O)O)c2ccc(Cl)cc2)OC1(C)C |
| InChI | InChI=1S/C15H20BClO4/c1-14(2)15(3,4)21-16(20-14)12(9-13(18)19)10-5-7-11(17)8-6-10/h5-8,12H,9H2,1-4H3,(H,18,19) |
| InChIKey | NLYDXNUWZOHZJB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|