C14H20BNO5 — CID 170815962
3-(6-oxo-1H-pyridin-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170815962) has the molecular formula C14H20BNO5 and a molecular weight of 293.13 g/mol. Its IUPAC name is 3-(6-oxo-1H-pyridin-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(6-oxo-1H-pyridin-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170815962 |
| Molecular Formula | C14H20BNO5 |
| Molecular Weight | 293.13 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-(6-oxo-1H-pyridin-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | CC1(C)OB(C(CC(=O)O)c2ccc(=O)[nH]c2)OC1(C)C |
| InChI | InChI=1S/C14H20BNO5/c1-13(2)14(3,4)21-15(20-13)10(7-12(18)19)9-5-6-11(17)16-8-9/h5-6,8,10H,7H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | ABMMSCQIILNFDR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|