C18H27BO3 — CID 102279434
(1S)-4-methyl-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-3-one (PubChem CID 102279434) has the molecular formula C18H27BO3 and a molecular weight of 302.22 g/mol. Its IUPAC name is (1S)-4-methyl-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-3-one.
| Compound Name | (1S)-4-methyl-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-3-one |
|---|---|
| PubChem CID | 102279434 |
| Molecular Formula | C18H27BO3 |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (1S)-4-methyl-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-3-one |
| SMILES | CC(C)C(=O)C[C@H](B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C18H27BO3/c1-13(2)16(20)12-15(14-10-8-7-9-11-14)19-21-17(3,4)18(5,6)22-19/h7-11,13,15H,12H2,1-6H3/t15-/m0/s1 |
| InChIKey | HYTWWSFRRXCXIJ-HNNXBMFYSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|