C23H29BO5 — CID 170816112
methyl 3-[4-(2-methoxyphenyl)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816112) has the molecular formula C23H29BO5 and a molecular weight of 396.29 g/mol. Its IUPAC name is methyl 3-[4-(2-methoxyphenyl)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-[4-(2-methoxyphenyl)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816112 |
| Molecular Formula | C23H29BO5 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | methyl 3-[4-(2-methoxyphenyl)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccc(-c2ccccc2OC)cc1 |
| InChI | InChI=1S/C23H29BO5/c1-22(2)23(3,4)29-24(28-22)19(15-21(25)27-6)17-13-11-16(12-14-17)18-9-7-8-10-20(18)26-5/h7-14,19H,15H2,1-6H3 |
| InChIKey | YVKIRZYNEGXDCY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|