C17H24BIO6 — CID 170816452
methyl 3-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816452) has the molecular formula C17H24BIO6 and a molecular weight of 462.09 g/mol. Its IUPAC name is methyl 3-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816452 |
| Molecular Formula | C17H24BIO6 |
| Molecular Weight | 462.09 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | methyl 3-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1cc(I)c(O)c(OC)c1 |
| InChI | InChI=1S/C17H24BIO6/c1-16(2)17(3,4)25-18(24-16)11(9-14(20)23-6)10-7-12(19)15(21)13(8-10)22-5/h7-8,11,21H,9H2,1-6H3 |
| InChIKey | OZVKJSDORDFVNS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.09 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|