C15H21BFNO4 — CID 170816557
methyl 3-(5-fluoro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816557) has the molecular formula C15H21BFNO4 and a molecular weight of 309.15 g/mol. Its IUPAC name is methyl 3-(5-fluoro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-(5-fluoro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816557 |
| Molecular Formula | C15H21BFNO4 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | methyl 3-(5-fluoro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1cncc(F)c1 |
| InChI | InChI=1S/C15H21BFNO4/c1-14(2)15(3,4)22-16(21-14)12(7-13(19)20-5)10-6-11(17)9-18-8-10/h6,8-9,12H,7H2,1-5H3 |
| InChIKey | PDTLDQWTJYDPRI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|