C14H19BCl2N2O4 — CID 170816673
methyl 3-(4,6-dichloropyrimidin-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816673) has the molecular formula C14H19BCl2N2O4 and a molecular weight of 361.03 g/mol. Its IUPAC name is methyl 3-(4,6-dichloropyrimidin-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-(4,6-dichloropyrimidin-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816673 |
| Molecular Formula | C14H19BCl2N2O4 |
| Molecular Weight | 361.03 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | methyl 3-(4,6-dichloropyrimidin-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C14H19BCl2N2O4/c1-13(2)14(3,4)23-15(22-13)8(6-9(20)21-5)10-11(16)18-7-19-12(10)17/h7-8H,6H2,1-5H3 |
| InChIKey | WMLBMFDDLLZNRE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.03 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|