C15H20BCl2NO4 — CID 170816565
methyl 3-(2,4-dichloro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816565) has the molecular formula C15H20BCl2NO4 and a molecular weight of 360.05 g/mol. Its IUPAC name is methyl 3-(2,4-dichloro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-(2,4-dichloro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816565 |
| Molecular Formula | C15H20BCl2NO4 |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | methyl 3-(2,4-dichloro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1c(Cl)ccnc1Cl |
| InChI | InChI=1S/C15H20BCl2NO4/c1-14(2)15(3,4)23-16(22-14)9(8-11(20)21-5)12-10(17)6-7-19-13(12)18/h6-7,9H,8H2,1-5H3 |
| InChIKey | XGMVKNBNZVDIOE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|