C22H29BO5 — CID 170816087
methyl 3-(2-ethoxynaphthalen-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816087) has the molecular formula C22H29BO5 and a molecular weight of 384.28 g/mol. Its IUPAC name is methyl 3-(2-ethoxynaphthalen-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-(2-ethoxynaphthalen-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816087 |
| Molecular Formula | C22H29BO5 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | methyl 3-(2-ethoxynaphthalen-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CCOc1ccc2ccccc2c1C(CC(=O)OC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H29BO5/c1-7-26-18-13-12-15-10-8-9-11-16(15)20(18)17(14-19(24)25-6)23-27-21(2,3)22(4,5)28-23/h8-13,17H,7,14H2,1-6H3 |
| InChIKey | FPLIGECVXPRKKC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|