C18H23BO4S — CID 170816529
methyl 3-(1-benzothiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816529) has the molecular formula C18H23BO4S and a molecular weight of 346.26 g/mol. Its IUPAC name is methyl 3-(1-benzothiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-(1-benzothiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816529 |
| Molecular Formula | C18H23BO4S |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | methyl 3-(1-benzothiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H23BO4S/c1-17(2)18(3,4)23-19(22-17)13(11-16(20)21-5)15-10-12-8-6-7-9-14(12)24-15/h6-10,13H,11H2,1-5H3 |
| InChIKey | QNZYWPAWGMBSDD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|