C17H23BF2O5 — CID 170816482
methyl 3-[2-(difluoromethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816482) has the molecular formula C17H23BF2O5 and a molecular weight of 356.17 g/mol. Its IUPAC name is methyl 3-[2-(difluoromethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-[2-(difluoromethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816482 |
| Molecular Formula | C17H23BF2O5 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | methyl 3-[2-(difluoromethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C17H23BF2O5/c1-16(2)17(3,4)25-18(24-16)12(10-14(21)22-5)11-8-6-7-9-13(11)23-15(19)20/h6-9,12,15H,10H2,1-5H3 |
| InChIKey | LAEHLZKWAQDIMR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|